C11H15N3O5 — CID 2825762
N'-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbohydrazide (PubChem CID 2825762) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is N'-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2825762 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N'-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC1OC[C@H](O)[C@H](O)[C@H]1O)c1cccnc1 |
| InChI | InChI=1S/C11H15N3O5/c15-7-5-19-11(9(17)8(7)16)14-13-10(18)6-2-1-3-12-4-6/h1-4,7-9,11,14-17H,5H2,(H,13,18)/t7-,8-,9+,11?/m0/s1 |
| InChIKey | PSDNVDRXIHPBOY-CAWYRIKXSA-N |
| XLogP | -2.24 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|