C9H8N2S2 — CID 2825779
5-phenyl-3,6-dihydro-1,3,4-thiadiazine-2-thione (PubChem CID 2825779) has the molecular formula C9H8N2S2 and a molecular weight of 208.31 g/mol. Its IUPAC name is 5-phenyl-3,6-dihydro-1,3,4-thiadiazine-2-thione.
| Compound Name | 5-phenyl-3,6-dihydro-1,3,4-thiadiazine-2-thione |
|---|---|
| PubChem CID | 2825779 |
| Molecular Formula | C9H8N2S2 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 5-phenyl-3,6-dihydro-1,3,4-thiadiazine-2-thione |
| SMILES | S=C1NN=C(c2ccccc2)CS1 |
| InChI | InChI=1S/C9H8N2S2/c12-9-11-10-8(6-13-9)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| InChIKey | ORJDJOIFXXPACS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|