C19H27NO11S — CID 2825782
methyl (2S,4R)-3-acetyl-2-[(1S,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 2825782) has the molecular formula C19H27NO11S and a molecular weight of 477.49 g/mol. Its IUPAC name is methyl (2S,4R)-3-acetyl-2-[(1S,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2S,4R)-3-acetyl-2-[(1S,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 2825782 |
| Molecular Formula | C19H27NO11S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | methyl (2S,4R)-3-acetyl-2-[(1S,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)N1C(C)=O |
| InChI | InChI=1S/C19H27NO11S/c1-9(21)20-14(19(26)27-6)8-32-18(20)17(31-13(5)25)16(30-12(4)24)15(29-11(3)23)7-28-10(2)22/h14-18H,7-8H2,1-6H3/t14-,15+,16+,17-,18-/m0/s1 |
| InChIKey | WXEUINBQJQHTDK-PNKHAZJDSA-N |
| XLogP | -0.19 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|