C22H31NO13S — CID 2825783
methyl (2S,4R)-3-acetyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 2825783) has the molecular formula C22H31NO13S and a molecular weight of 549.55 g/mol. Its IUPAC name is methyl (2S,4R)-3-acetyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2S,4R)-3-acetyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 2825783 |
| Molecular Formula | C22H31NO13S |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | methyl (2S,4R)-3-acetyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@@H]([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)N1C(C)=O |
| InChI | InChI=1S/C22H31NO13S/c1-10(24)23-16(22(30)31-7)9-37-21(23)20(36-15(6)29)19(35-14(5)28)18(34-13(4)27)17(33-12(3)26)8-32-11(2)25/h16-21H,8-9H2,1-7H3/t16-,17+,18-,19-,20+,21-/m0/s1 |
| InChIKey | BGKAKBCIPMOKCW-FITZOCOBSA-N |
| XLogP | -0.26 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|