C21H22O10S2 — CID 2825808
[(2R,3R,3aS,6aS)-2-methoxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 4-methylbenzenesulfonate (PubChem CID 2825808) has the molecular formula C21H22O10S2 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(2R,3R,3aS,6aS)-2-methoxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,3aS,6aS)-2-methoxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2825808 |
| Molecular Formula | C21H22O10S2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [(2R,3R,3aS,6aS)-2-methoxy-6-(4-methylphenyl)sulfonyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@H]2C(OS(=O)(=O)c3ccc(C)cc3)C(=O)O[C@@H]2[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O10S2/c1-12-4-8-14(9-5-12)32(23,24)30-18-16-17(28-20(18)22)19(21(27-3)29-16)31-33(25,26)15-10-6-13(2)7-11-15/h4-11,16-19,21H,1-3H3/t16-,17-,18?,19+,21+/m0/s1 |
| InChIKey | BMSROLZPJNEVRO-UGRSUEEJSA-N |
| XLogP | 1.45 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|