About 2-pyren-2-ylacetonitrile
2-pyren-2-ylacetonitrile (PubChem CID 2825910) has the molecular formula C18H11N
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-pyren-2-ylacetonitrile.
Molecular Properties
| Compound Name | 2-pyren-2-ylacetonitrile |
| PubChem CID | 2825910 |
| Molecular Formula | C18H11N |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-pyren-2-ylacetonitrile |
| SMILES | N#CCc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C18H11N/c19-9-8-12-10-15-6-4-13-2-1-3-14-5-7-16(11-12)18(15)17(13)14/h1-7,10-11H,8H2 |
| InChIKey | AXTONQSVCXAXGI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-pyren-2-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyren-2-ylacetonitrile?
The IUPAC name of 2-pyren-2-ylacetonitrile (CID 2825910) is 2-pyren-2-ylacetonitrile.
What is the SMILES notation for 2-pyren-2-ylacetonitrile?
The canonical SMILES for 2-pyren-2-ylacetonitrile is N#CCc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2-pyren-2-ylacetonitrile?
The InChIKey is AXTONQSVCXAXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N/c19-9-8-12-10-15-6-4-13-2-1-3-14-5-7-16(11-12)18(15)17(13)14/h1-7,10-11H,8H2.
What are the key properties of 2-pyren-2-ylacetonitrile?
2-pyren-2-ylacetonitrile has a molecular weight of 241.29 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyren-2-ylacetonitrile is sourced from PubChem (CID 2825910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).