About 2-anilino-1,3-benzoxazin-4-one
2-anilino-1,3-benzoxazin-4-one (PubChem CID 2825993) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-anilino-1,3-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-anilino-1,3-benzoxazin-4-one |
| PubChem CID | 2825993 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-anilino-1,3-benzoxazin-4-one |
| SMILES | O=c1nc(Nc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C14H10N2O2/c17-13-11-8-4-5-9-12(11)18-14(16-13)15-10-6-2-1-3-7-10/h1-9H,(H,15,16,17) |
| InChIKey | NDHHRLYSIAEHKJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilino-1,3-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-1,3-benzoxazin-4-one?
The IUPAC name of 2-anilino-1,3-benzoxazin-4-one (CID 2825993) is 2-anilino-1,3-benzoxazin-4-one.
What is the SMILES notation for 2-anilino-1,3-benzoxazin-4-one?
The canonical SMILES for 2-anilino-1,3-benzoxazin-4-one is O=c1nc(Nc2ccccc2)oc2ccccc12.
What is the InChIKey of 2-anilino-1,3-benzoxazin-4-one?
The InChIKey is NDHHRLYSIAEHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-13-11-8-4-5-9-12(11)18-14(16-13)15-10-6-2-1-3-7-10/h1-9H,(H,15,16,17).
What are the key properties of 2-anilino-1,3-benzoxazin-4-one?
2-anilino-1,3-benzoxazin-4-one has a molecular weight of 238.25 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-1,3-benzoxazin-4-one is sourced from PubChem (CID 2825993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).