About [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate
[4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate (PubChem CID 2826010) has the molecular formula C19H12N2O2S
and a molecular weight of 332.38 g/mol. Its IUPAC name is [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate |
| PubChem CID | 2826010 |
| Molecular Formula | C19H12N2O2S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate |
| SMILES | N#CC(=Cc1ccc(OC(=O)c2cccs2)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H12N2O2S/c20-13-15(17-4-1-2-10-21-17)12-14-6-8-16(9-7-14)23-19(22)18-5-3-11-24-18/h1-12H |
| InChIKey | RGUSELSZHHYJGB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate?
The IUPAC name of [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate (CID 2826010) is [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate.
What is the SMILES notation for [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate?
The canonical SMILES for [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate is N#CC(=Cc1ccc(OC(=O)c2cccs2)cc1)c1ccccn1.
What is the InChIKey of [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate?
The InChIKey is RGUSELSZHHYJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2O2S/c20-13-15(17-4-1-2-10-21-17)12-14-6-8-16(9-7-14)23-19(22)18-5-3-11-24-18/h1-12H.
What are the key properties of [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate?
[4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate has a molecular weight of 332.38 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-cyano-2-pyridin-2-ylethenyl)phenyl] thiophene-2-carboxylate is sourced from PubChem (CID 2826010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).