About S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate
S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate (PubChem CID 2826089) has the molecular formula C16H19NO3S
and a molecular weight of 305.40 g/mol. Its IUPAC name is S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate |
| PubChem CID | 2826089 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C16H19NO3S/c1-10(18)21-13-9-14(19)17(15(13)20)12-7-5-11(6-8-12)16(2,3)4/h5-8,13H,9H2,1-4H3 |
| InChIKey | VKKGGGCJBJIMEI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate?
The IUPAC name of S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate (CID 2826089) is S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate.
What is the SMILES notation for S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate?
The canonical SMILES for S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate is CC(=O)SC1CC(=O)N(c2ccc(C(C)(C)C)cc2)C1=O.
What is the InChIKey of S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate?
The InChIKey is VKKGGGCJBJIMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3S/c1-10(18)21-13-9-14(19)17(15(13)20)12-7-5-11(6-8-12)16(2,3)4/h5-8,13H,9H2,1-4H3.
What are the key properties of S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate?
S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate has a molecular weight of 305.40 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-(4-tert-butylphenyl)-2,5-dioxopyrrolidin-3-yl] ethanethioate is sourced from PubChem (CID 2826089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).