C23H21N3O4 — CID 2826297
5,7-bis(4-methoxyphenyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2826297) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5,7-bis(4-methoxyphenyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5,7-bis(4-methoxyphenyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2826297 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5,7-bis(4-methoxyphenyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c3c(=O)n(C)c(=O)n(C)c3n2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-25-21-20(22(27)26(2)23(25)28)18(14-5-9-16(29-3)10-6-14)13-19(24-21)15-7-11-17(30-4)12-8-15/h5-13H,1-4H3 |
| InChIKey | MQRFZXGYRUZODW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |