C18H24N4O2 — CID 2826428
6-[(1-benzylpiperidin-4-yl)amino]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 2826428) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-[(1-benzylpiperidin-4-yl)amino]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[(1-benzylpiperidin-4-yl)amino]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2826428 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 6-[(1-benzylpiperidin-4-yl)amino]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(NC2CCN(Cc3ccccc3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C18H24N4O2/c1-20-16(12-17(23)21(2)18(20)24)19-15-8-10-22(11-9-15)13-14-6-4-3-5-7-14/h3-7,12,15,19H,8-11,13H2,1-2H3 |
| InChIKey | SBHIQJPDOJDCOA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |