C32H28N2O4 — CID 2826527
2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,5-dimethylhexan-2-yl]benzo[de]isoquinoline-1,3-dione (PubChem CID 2826527) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,5-dimethylhexan-2-yl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,5-dimethylhexan-2-yl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2826527 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 2-[5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2,5-dimethylhexan-2-yl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)(CCC(C)(C)N1C(=O)c2cccc3cccc(c23)C1=O)N1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C32H28N2O4/c1-31(2,33-27(35)21-13-5-9-19-10-6-14-22(25(19)21)28(33)36)17-18-32(3,4)34-29(37)23-15-7-11-20-12-8-16-24(26(20)23)30(34)38/h5-16H,17-18H2,1-4H3 |
| InChIKey | XCCRTLXGWJJYGG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|