C11H13Cl2N5 — CID 2826582
1-(2,6-dichlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 2826582) has the molecular formula C11H13Cl2N5 and a molecular weight of 286.17 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-(2,6-dichlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2826582 |
| Molecular Formula | C11H13Cl2N5 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2N5/c1-11(2)17-9(14)16-10(15)18(11)8-6(12)4-3-5-7(8)13/h3-5H,1-2H3,(H4,14,15,16,17) |
| InChIKey | OOGAEDMXJRVYCH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |