About 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one
2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 2826689) has the molecular formula C14H10Cl2N2O2S
and a molecular weight of 341.22 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| PubChem CID | 2826689 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2cccc(Cl)c2Cl)N1Cc1ccco1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c15-10-4-1-5-11(13(10)16)17-14-18(12(19)8-21-14)7-9-3-2-6-20-9/h1-6H,7-8H2/b17-14- |
| InChIKey | NAQDVYWYWDAQCM-VKAVYKQESA-N |
| XLogP | 4.35 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (CID 2826689) is 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one is O=C1CS/C(=N\c2cccc(Cl)c2Cl)N1Cc1ccco1.
What is the InChIKey of 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one?
The InChIKey is NAQDVYWYWDAQCM-VKAVYKQESA-N. The full InChI is InChI=1S/C14H10Cl2N2O2S/c15-10-4-1-5-11(13(10)16)17-14-18(12(19)8-21-14)7-9-3-2-6-20-9/h1-6H,7-8H2/b17-14-.
What are the key properties of 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one?
2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one has a molecular weight of 341.22 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenyl)imino-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 2826689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).