About N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide
N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide (PubChem CID 2826700) has the molecular formula C13H17IN2S
and a molecular weight of 360.26 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide.
Molecular Properties
| Compound Name | N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide |
| PubChem CID | 2826700 |
| Molecular Formula | C13H17IN2S |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide |
| SMILES | Cc1cccc(C)c1Nc1scc(C)[n+]1C.[I-] |
| InChI | InChI=1S/C13H16N2S.HI/c1-9-6-5-7-10(2)12(9)14-13-15(4)11(3)8-16-13;/h5-8H,1-4H3;1H |
| InChIKey | JIZNJNNGNVEVIK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazole_amine_D(3)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide?
The IUPAC name of N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide (CID 2826700) is N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide.
What is the SMILES notation for N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide?
The canonical SMILES for N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide is Cc1cccc(C)c1Nc1scc(C)[n+]1C.[I-].
What is the InChIKey of N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide?
The InChIKey is JIZNJNNGNVEVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S.HI/c1-9-6-5-7-10(2)12(9)14-13-15(4)11(3)8-16-13;/h5-8H,1-4H3;1H.
What are the key properties of N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide?
N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide has a molecular weight of 360.26 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)-3,4-dimethyl-1,3-thiazol-3-ium-2-amine iodide is sourced from PubChem (CID 2826700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).