2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid

C9H11BrN2O4 — CID 2827025

IUPAC2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid
SMILESCc1nn(C(CC(=O)O)C(=O)O)c(C)c1Br
InChIInChI=1S/C9H11BrN2O4/c1-4-8(10)5(2)12(11-4)6(9(15)16)3-7(13)14/h6H,3H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyBOSYIMSPNWXYOX-UHFFFAOYSA-N
MW291.10 g/mol
LogP1.36
Rot. Bonds4

About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid

2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid (PubChem CID 2827025) has the molecular formula C9H11BrN2O4 and a molecular weight of 291.10 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid.

Molecular Properties

Compound Name2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid
PubChem CID2827025
Molecular FormulaC9H11BrN2O4
Molecular Weight291.10 g/mol
Exact Mass289.99
IUPAC Name2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid
SMILESCc1nn(C(CC(=O)O)C(=O)O)c(C)c1Br
InChIInChI=1S/C9H11BrN2O4/c1-4-8(10)5(2)12(11-4)6(9(15)16)3-7(13)14/h6H,3H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyBOSYIMSPNWXYOX-UHFFFAOYSA-N
XLogP1.36
TPSA92.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.10
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid (CID 2827025) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid is Cc1nn(C(CC(=O)O)C(=O)O)c(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid?
The InChIKey is BOSYIMSPNWXYOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O4/c1-4-8(10)5(2)12(11-4)6(9(15)16)3-7(13)14/h6H,3H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid has a molecular weight of 291.10 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)butanedioic acid is sourced from PubChem (CID 2827025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).