About 2-ethylsulfonylethenyl carbamimidothioate
2-ethylsulfonylethenyl carbamimidothioate (PubChem CID 2827191) has the molecular formula C5H10N2O2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-ethylsulfonylethenyl carbamimidothioate.
Molecular Properties
| Compound Name | 2-ethylsulfonylethenyl carbamimidothioate |
| PubChem CID | 2827191 |
| Molecular Formula | C5H10N2O2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2-ethylsulfonylethenyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC=CS(=O)(=O)CC |
| InChI | InChI=1S/C5H10N2O2S2/c1-2-11(8,9)4-3-10-5(6)7/h3-4H,2H2,1H3,(H3,6,7) |
| InChIKey | PFLBYQIKOFSMLA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfonylethenyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonylethenyl carbamimidothioate?
The IUPAC name of 2-ethylsulfonylethenyl carbamimidothioate (CID 2827191) is 2-ethylsulfonylethenyl carbamimidothioate.
What is the SMILES notation for 2-ethylsulfonylethenyl carbamimidothioate?
The canonical SMILES for 2-ethylsulfonylethenyl carbamimidothioate is [H]/N=C(\N)SC=CS(=O)(=O)CC.
What is the InChIKey of 2-ethylsulfonylethenyl carbamimidothioate?
The InChIKey is PFLBYQIKOFSMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2S2/c1-2-11(8,9)4-3-10-5(6)7/h3-4H,2H2,1H3,(H3,6,7).
What are the key properties of 2-ethylsulfonylethenyl carbamimidothioate?
2-ethylsulfonylethenyl carbamimidothioate has a molecular weight of 194.28 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonylethenyl carbamimidothioate is sourced from PubChem (CID 2827191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).