About ethyl 3-benzamidopropanoate
ethyl 3-benzamidopropanoate (PubChem CID 2827265) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 3-benzamidopropanoate.
Molecular Properties
| Compound Name | ethyl 3-benzamidopropanoate |
| PubChem CID | 2827265 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl 3-benzamidopropanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-2-16-11(14)8-9-13-12(15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,15) |
| InChIKey | OEKIULQFBZZRGS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-benzamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzamidopropanoate?
The IUPAC name of ethyl 3-benzamidopropanoate (CID 2827265) is ethyl 3-benzamidopropanoate.
What is the SMILES notation for ethyl 3-benzamidopropanoate?
The canonical SMILES for ethyl 3-benzamidopropanoate is CCOC(=O)CCNC(=O)c1ccccc1.
What is the InChIKey of ethyl 3-benzamidopropanoate?
The InChIKey is OEKIULQFBZZRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-2-16-11(14)8-9-13-12(15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,15).
What are the key properties of ethyl 3-benzamidopropanoate?
ethyl 3-benzamidopropanoate has a molecular weight of 221.26 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzamidopropanoate is sourced from PubChem (CID 2827265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).