About 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole
2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole (PubChem CID 2827281) has the molecular formula C21H17N3O2
and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 2827281 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3O2/c25-24(26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16/h1-14,21H,15H2 |
| InChIKey | UJRZNOKABKPMIK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole (CID 2827281) is 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole is O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole?
The InChIKey is UJRZNOKABKPMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2/c25-24(26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16/h1-14,21H,15H2.
What are the key properties of 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole?
2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole has a molecular weight of 343.39 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-3,5-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 2827281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).