C11H16O4 — CID 2827410
3,3,5-trimethylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 2827410) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 3,3,5-trimethylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | 3,3,5-trimethylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 2827410 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3,3,5-trimethylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | CC1=CC(C)(C)C(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C11H16O4/c1-6-4-7(9(12)13)8(10(14)15)11(2,3)5-6/h5,7-8H,4H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | FXRAOARZHSCPPN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|