C19H19F7N6OS — CID 2827789
6-(cyclohexylideneamino)oxy-2-N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 2827789) has the molecular formula C19H19F7N6OS and a molecular weight of 512.46 g/mol. Its IUPAC name is 6-(cyclohexylideneamino)oxy-2-N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(cyclohexylideneamino)oxy-2-N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2827789 |
| Molecular Formula | C19H19F7N6OS |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 6-(cyclohexylideneamino)oxy-2-N-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2SC(F)(F)C(F)(F)C(F)(F)F)nc(ON=C2CCCCC2)n1 |
| InChI | InChI=1S/C19H19F7N6OS/c1-27-14-29-15(31-16(30-14)33-32-11-7-3-2-4-8-11)28-12-9-5-6-10-13(12)34-19(25,26)17(20,21)18(22,23)24/h5-6,9-10H,2-4,7-8H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | ZEGDWTASCOFZIP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|