About (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride
(2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride (PubChem CID 2827816) has the molecular formula C19H26ClNO2
and a molecular weight of 335.88 g/mol. Its IUPAC name is (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride |
| PubChem CID | 2827816 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride |
| SMILES | CCc1nc(C)ccc1OC(=O)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C19H25NO2.ClH/c1-3-16-17(5-4-12(2)20-16)22-18(21)19-9-13-6-14(10-19)8-15(7-13)11-19;/h4-5,13-15H,3,6-11H2,1-2H3;1H |
| InChIKey | OAHOGGFADQVYER-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride?
The IUPAC name of (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride (CID 2827816) is (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride.
What is the SMILES notation for (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride?
The canonical SMILES for (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride is CCc1nc(C)ccc1OC(=O)C12CC3CC(CC(C3)C1)C2.Cl.
What is the InChIKey of (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride?
The InChIKey is OAHOGGFADQVYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2.ClH/c1-3-16-17(5-4-12(2)20-16)22-18(21)19-9-13-6-14(10-19)8-15(7-13)11-19;/h4-5,13-15H,3,6-11H2,1-2H3;1H.
What are the key properties of (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride?
(2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride has a molecular weight of 335.88 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6-methyl-3-pyridinyl) adamantane-1-carboxylate;hydrochloride is sourced from PubChem (CID 2827816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).