About [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride
[2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride (PubChem CID 2827818) has the molecular formula C24H28ClNO4
and a molecular weight of 429.94 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride |
| PubChem CID | 2827818 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride |
| SMILES | COc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1OC.Cl |
| InChI | InChI=1S/C24H27NO4.ClH/c1-27-19-6-5-18(11-21(19)28-2)22-20(4-3-7-25-22)29-23(26)24-12-15-8-16(13-24)10-17(9-15)14-24;/h3-7,11,15-17H,8-10,12-14H2,1-2H3;1H |
| InChIKey | PJYRYXNFHGOKCW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The IUPAC name of [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride (CID 2827818) is [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride.
What is the SMILES notation for [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The canonical SMILES for [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride is COc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1OC.Cl.
What is the InChIKey of [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
The InChIKey is PJYRYXNFHGOKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO4.ClH/c1-27-19-6-5-18(11-21(19)28-2)22-20(4-3-7-25-22)29-23(26)24-12-15-8-16(13-24)10-17(9-15)14-24;/h3-7,11,15-17H,8-10,12-14H2,1-2H3;1H.
What are the key properties of [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride?
[2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride has a molecular weight of 429.94 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrochloride is sourced from PubChem (CID 2827818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).