C12H9N3O3 — CID 2827992
2,4,6-tris(prop-2-ynoxy)-1,3,5-triazine (PubChem CID 2827992) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2,4,6-tris(prop-2-ynoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(prop-2-ynoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 2827992 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2,4,6-tris(prop-2-ynoxy)-1,3,5-triazine |
| SMILES | C#CCOc1nc(OCC#C)nc(OCC#C)n1 |
| InChI | InChI=1S/C12H9N3O3/c1-4-7-16-10-13-11(17-8-5-2)15-12(14-10)18-9-6-3/h1-3H,7-9H2 |
| InChIKey | DRFJNVUYUQQIDX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|