C19H25NO — CID 2828140
(3Z)-1,7,7-trimethyl-3-[(1-phenylethylamino)methylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 2828140) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (3Z)-1,7,7-trimethyl-3-[(1-phenylethylamino)methylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (3Z)-1,7,7-trimethyl-3-[(1-phenylethylamino)methylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 2828140 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (3Z)-1,7,7-trimethyl-3-[(1-phenylethylamino)methylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC(N/C=C1\C(=O)C2(C)CCC1C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO/c1-13(14-8-6-5-7-9-14)20-12-15-16-10-11-19(4,17(15)21)18(16,2)3/h5-9,12-13,16,20H,10-11H2,1-4H3/b15-12- |
| InChIKey | ALKIQXJQXTWWDL-QINSGFPZSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|