C11H6F12O4 — CID 2828261
1,1,1,3,3,3-hexafluoro-2-[5-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]furan-2-yl]propan-2-ol (PubChem CID 2828261) has the molecular formula C11H6F12O4 and a molecular weight of 430.14 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[5-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]furan-2-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[5-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]furan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 2828261 |
| Molecular Formula | C11H6F12O4 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[5-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]furan-2-yl]propan-2-ol |
| SMILES | OC(OCc1ccc(C(O)(C(F)(F)F)C(F)(F)F)o1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F12O4/c12-8(13,14)6(24,9(15,16)17)5-2-1-4(27-5)3-26-7(25,10(18,19)20)11(21,22)23/h1-2,24-25H,3H2 |
| InChIKey | CKTYUVDYEJBNJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|