C20H34ClNO2 — CID 2828561
benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium chloride (PubChem CID 2828561) has the molecular formula C20H34ClNO2 and a molecular weight of 355.95 g/mol. Its IUPAC name is benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium chloride.
| Compound Name | benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium chloride |
|---|---|
| PubChem CID | 2828561 |
| Molecular Formula | C20H34ClNO2 |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium chloride |
| SMILES | CC1CC(C)(C)OC(C(C)(C)C[N+](C)(C)Cc2ccccc2)O1.[Cl-] |
| InChI | InChI=1S/C20H34NO2.ClH/c1-16-13-20(4,5)23-18(22-16)19(2,3)15-21(6,7)14-17-11-9-8-10-12-17;/h8-12,16,18H,13-15H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | VPBLCDAEGWHIAL-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|