C20H34NO2+ — CID 2828562
benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium (PubChem CID 2828562) has the molecular formula C20H34NO2+ and a molecular weight of 320.50 g/mol. Its IUPAC name is benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium.
| Compound Name | benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 2828562 |
| Molecular Formula | C20H34NO2+ |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | benzyl-dimethyl-[2-methyl-2-(4,4,6-trimethyl-1,3-dioxan-2-yl)propyl]azanium |
| SMILES | CC1CC(C)(C)OC(C(C)(C)C[N+](C)(C)Cc2ccccc2)O1 |
| InChI | InChI=1S/C20H34NO2/c1-16-13-20(4,5)23-18(22-16)19(2,3)15-21(6,7)14-17-11-9-8-10-12-17/h8-12,16,18H,13-15H2,1-7H3/q+1 |
| InChIKey | YNHRDZNKRQDHKG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|