About [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate
[2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate (PubChem CID 2828614) has the molecular formula C21H22N2O7
and a molecular weight of 414.41 g/mol. Its IUPAC name is [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate.
Molecular Properties
| Compound Name | [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate |
| PubChem CID | 2828614 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate |
| SMILES | COc1cc2c(cc1OC)C(c1cc([N+](=O)[O-])ccc1OC(C)=O)N(C(C)=O)CC2 |
| InChI | InChI=1S/C21H22N2O7/c1-12(24)22-8-7-14-9-19(28-3)20(29-4)11-16(14)21(22)17-10-15(23(26)27)5-6-18(17)30-13(2)25/h5-6,9-11,21H,7-8H2,1-4H3 |
| InChIKey | BAAIBJBFQDVBGP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate?
The IUPAC name of [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate (CID 2828614) is [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate.
What is the SMILES notation for [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate?
The canonical SMILES for [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate is COc1cc2c(cc1OC)C(c1cc([N+](=O)[O-])ccc1OC(C)=O)N(C(C)=O)CC2.
What is the InChIKey of [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate?
The InChIKey is BAAIBJBFQDVBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O7/c1-12(24)22-8-7-14-9-19(28-3)20(29-4)11-16(14)21(22)17-10-15(23(26)27)5-6-18(17)30-13(2)25/h5-6,9-11,21H,7-8H2,1-4H3.
What are the key properties of [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate?
[2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate has a molecular weight of 414.41 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-acetyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-4-nitrophenyl] acetate is sourced from PubChem (CID 2828614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).