C14H15BrN2S — CID 2828874
6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 2828874) has the molecular formula C14H15BrN2S and a molecular weight of 323.26 g/mol. Its IUPAC name is 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 2828874 |
| Molecular Formula | C14H15BrN2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | Cc1ccccc1Cn1c(C)c[n+]2ccsc12.[Br-] |
| InChI | InChI=1S/C14H15N2S.BrH/c1-11-5-3-4-6-13(11)10-16-12(2)9-15-7-8-17-14(15)16;/h3-9H,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YPPDTRPJBPTELX-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|