C42H50O2S3 — CID 2828997
S-[4-[4-(3,5-ditert-butylbenzoyl)sulfanylphenyl]sulfanylphenyl] 3,5-ditert-butylbenzenecarbothioate (PubChem CID 2828997) has the molecular formula C42H50O2S3 and a molecular weight of 683.06 g/mol. Its IUPAC name is S-[4-[4-(3,5-ditert-butylbenzoyl)sulfanylphenyl]sulfanylphenyl] 3,5-ditert-butylbenzenecarbothioate.
| Compound Name | S-[4-[4-(3,5-ditert-butylbenzoyl)sulfanylphenyl]sulfanylphenyl] 3,5-ditert-butylbenzenecarbothioate |
|---|---|
| PubChem CID | 2828997 |
| Molecular Formula | C42H50O2S3 |
| Molecular Weight | 683.06 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | S-[4-[4-(3,5-ditert-butylbenzoyl)sulfanylphenyl]sulfanylphenyl] 3,5-ditert-butylbenzenecarbothioate |
| SMILES | CC(C)(C)c1cc(C(=O)Sc2ccc(Sc3ccc(SC(=O)c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H50O2S3/c1-39(2,3)29-21-27(22-30(25-29)40(4,5)6)37(43)46-35-17-13-33(14-18-35)45-34-15-19-36(20-16-34)47-38(44)28-23-31(41(7,8)9)26-32(24-28)42(10,11)12/h13-26H,1-12H3 |
| InChIKey | DZBSDMAXLHVIMS-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.06 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|