About [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine
[5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (PubChem CID 2829039) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| PubChem CID | 2829039 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| SMILES | CC1(C)OC(CN)C(CN)O1 |
| InChI | InChI=1S/C7H16N2O2/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6H,3-4,8-9H2,1-2H3 |
| InChIKey | KQGQLRAYJUXGOW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The IUPAC name of [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (CID 2829039) is [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
What is the SMILES notation for [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The canonical SMILES for [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine is CC1(C)OC(CN)C(CN)O1.
What is the InChIKey of [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The InChIKey is KQGQLRAYJUXGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6H,3-4,8-9H2,1-2H3.
What are the key properties of [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
[5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine has a molecular weight of 160.22 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine is sourced from PubChem (CID 2829039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).