About [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride
[2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride (PubChem CID 2829059) has the molecular formula C23H28ClNO4
and a molecular weight of 417.93 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride |
| PubChem CID | 2829059 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride |
| SMILES | COc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1.Cl.O |
| InChI | InChI=1S/C23H25NO3.ClH.H2O/c1-26-19-6-4-18(5-7-19)21-20(3-2-8-24-21)27-22(25)23-12-15-9-16(13-23)11-17(10-15)14-23;;/h2-8,15-17H,9-14H2,1H3;1H;1H2 |
| InChIKey | IVSHCUGCCQKZCP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride?
The IUPAC name of [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride (CID 2829059) is [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride.
What is the SMILES notation for [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride?
The canonical SMILES for [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride is COc1ccc(-c2ncccc2OC(=O)C23CC4CC(CC(C4)C2)C3)cc1.Cl.O.
What is the InChIKey of [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride?
The InChIKey is IVSHCUGCCQKZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO3.ClH.H2O/c1-26-19-6-4-18(5-7-19)21-20(3-2-8-24-21)27-22(25)23-12-15-9-16(13-23)11-17(10-15)14-23;;/h2-8,15-17H,9-14H2,1H3;1H;1H2.
What are the key properties of [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride?
[2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride has a molecular weight of 417.93 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)-3-pyridinyl] adamantane-1-carboxylate;hydrate;hydrochloride is sourced from PubChem (CID 2829059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).