C17H19N3 — CID 2829065
2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetonitrile (PubChem CID 2829065) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetonitrile.
| Compound Name | 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetonitrile |
|---|---|
| PubChem CID | 2829065 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetonitrile |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(CC#N)C3CCC1 |
| InChI | InChI=1S/C17H19N3/c1-12-5-6-15-14(11-12)13-3-2-4-16-17(13)20(15)10-9-19(16)8-7-18/h5-6,11,16H,2-4,8-10H2,1H3 |
| InChIKey | PLUHIADPSDMRFW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|