C26H19Br2NO3 — CID 2829203
1,8-dibromo-17-(2-ethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 2829203) has the molecular formula C26H19Br2NO3 and a molecular weight of 553.25 g/mol. Its IUPAC name is 1,8-dibromo-17-(2-ethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1,8-dibromo-17-(2-ethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 2829203 |
| Molecular Formula | C26H19Br2NO3 |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | 1,8-dibromo-17-(2-ethoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCOc1ccccc1N1C(=O)C2C(C1=O)C1(Br)c3ccccc3C2(Br)c2ccccc21 |
| InChI | InChI=1S/C26H19Br2NO3/c1-2-32-20-14-8-7-13-19(20)29-23(30)21-22(24(29)31)26(28)16-10-4-3-9-15(16)25(21,27)17-11-5-6-12-18(17)26/h3-14,21-22H,2H2,1H3 |
| InChIKey | WVQYDCKAHOYUPX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|