About 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone
1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone (PubChem CID 2829211) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone |
| PubChem CID | 2829211 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone |
| SMILES | CC(=O)N1CN(C(C)=O)C(O)C1O |
| InChI | InChI=1S/C7H12N2O4/c1-4(10)8-3-9(5(2)11)7(13)6(8)12/h6-7,12-13H,3H2,1-2H3 |
| InChIKey | UNVDEKZKNWGICE-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone?
The IUPAC name of 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone (CID 2829211) is 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone.
What is the SMILES notation for 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone?
The canonical SMILES for 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone is CC(=O)N1CN(C(C)=O)C(O)C1O.
What is the InChIKey of 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone?
The InChIKey is UNVDEKZKNWGICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c1-4(10)8-3-9(5(2)11)7(13)6(8)12/h6-7,12-13H,3H2,1-2H3.
What are the key properties of 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone?
1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone has a molecular weight of 188.18 g/mol, XLogP of -1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetyl-4,5-dihydroxyimidazolidin-1-yl)ethanone is sourced from PubChem (CID 2829211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).