About [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol
[6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 2829379) has the molecular formula C29H34O5S
and a molecular weight of 494.65 g/mol. Its IUPAC name is [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
Molecular Properties
| Compound Name | [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| PubChem CID | 2829379 |
| Molecular Formula | C29H34O5S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCSC1OC(CO)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O5S/c1-2-35-29-28(33-21-24-16-10-5-11-17-24)27(32-20-23-14-8-4-9-15-23)26(25(18-30)34-29)31-19-22-12-6-3-7-13-22/h3-17,25-30H,2,18-21H2,1H3 |
| InChIKey | AZQPSLVUJGSMNT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol?
The IUPAC name of [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (CID 2829379) is [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
What is the SMILES notation for [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol?
The canonical SMILES for [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol is CCSC1OC(CO)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol?
The InChIKey is AZQPSLVUJGSMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34O5S/c1-2-35-29-28(33-21-24-16-10-5-11-17-24)27(32-20-23-14-8-4-9-15-23)26(25(18-30)34-29)31-19-22-12-6-3-7-13-22/h3-17,25-30H,2,18-21H2,1H3.
What are the key properties of [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol?
[6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol has a molecular weight of 494.65 g/mol, XLogP of 5.21, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol is sourced from PubChem (CID 2829379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).