About 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]
6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] (PubChem CID 2829390) has the molecular formula C20H21NO2
and a molecular weight of 307.39 g/mol. Its IUPAC name is 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole].
Molecular Properties
| Compound Name | 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] |
| PubChem CID | 2829390 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] |
| SMILES | COc1ccc2c(c1)C=CC1(O2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C20H21NO2/c1-19(2)16-7-5-6-8-17(16)21(3)20(19)12-11-14-13-15(22-4)9-10-18(14)23-20/h5-13H,1-4H3 |
| InChIKey | AOSSPNVRJMKJNR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]?
The IUPAC name of 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] (CID 2829390) is 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole].
What is the SMILES notation for 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]?
The canonical SMILES for 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] is COc1ccc2c(c1)C=CC1(O2)N(C)c2ccccc2C1(C)C.
What is the InChIKey of 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]?
The InChIKey is AOSSPNVRJMKJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO2/c1-19(2)16-7-5-6-8-17(16)21(3)20(19)12-11-14-13-15(22-4)9-10-18(14)23-20/h5-13H,1-4H3.
What are the key properties of 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole]?
6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] has a molecular weight of 307.39 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1',3',3'-trimethylspiro[chromene-2,2'-indole] is sourced from PubChem (CID 2829390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).