About N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline
N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline (PubChem CID 2829506) has the molecular formula C21H25N5
and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline.
Molecular Properties
| Compound Name | N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline |
| PubChem CID | 2829506 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline |
| SMILES | Cc1cccc(C)c1-n1nnnc1C1(Nc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H25N5/c1-16-10-9-11-17(2)19(16)26-20(23-24-25-26)21(14-7-4-8-15-21)22-18-12-5-3-6-13-18/h3,5-6,9-13,22H,4,7-8,14-15H2,1-2H3 |
| InChIKey | SLRFFXWICPLLSM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline?
The IUPAC name of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline (CID 2829506) is N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline.
What is the SMILES notation for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline?
The canonical SMILES for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline is Cc1cccc(C)c1-n1nnnc1C1(Nc2ccccc2)CCCCC1.
What is the InChIKey of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline?
The InChIKey is SLRFFXWICPLLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5/c1-16-10-9-11-17(2)19(16)26-20(23-24-25-26)21(14-7-4-8-15-21)22-18-12-5-3-6-13-18/h3,5-6,9-13,22H,4,7-8,14-15H2,1-2H3.
What are the key properties of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline?
N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline has a molecular weight of 347.47 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]aniline is sourced from PubChem (CID 2829506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).