About benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate
benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 2829564) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate |
| PubChem CID | 2829564 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C1OCN(C(=O)OCc2ccccc2)C1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c20-17-16(11-14-7-3-1-4-8-14)19(13-23-17)18(21)22-12-15-9-5-2-6-10-15/h1-10,16H,11-13H2 |
| InChIKey | JUKOCCGVSRMWMD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The IUPAC name of benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate (CID 2829564) is benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate is O=C1OCN(C(=O)OCc2ccccc2)C1Cc1ccccc1.
What is the InChIKey of benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate?
The InChIKey is JUKOCCGVSRMWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4/c20-17-16(11-14-7-3-1-4-8-14)19(13-23-17)18(21)22-12-15-9-5-2-6-10-15/h1-10,16H,11-13H2.
What are the key properties of benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate?
benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate has a molecular weight of 311.34 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-benzyl-5-oxo-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 2829564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).