About N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine
N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine (PubChem CID 2829587) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine |
| PubChem CID | 2829587 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine |
| SMILES | NCCNc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C11H12N4O2/c12-5-7-13-9-3-4-10(15(16)17)8-2-1-6-14-11(8)9/h1-4,6,13H,5,7,12H2 |
| InChIKey | QWERJBJISYXSIZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine?
The IUPAC name of N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine (CID 2829587) is N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine is NCCNc1ccc([N+](=O)[O-])c2cccnc12.
What is the InChIKey of N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine?
The InChIKey is QWERJBJISYXSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c12-5-7-13-9-3-4-10(15(16)17)8-2-1-6-14-11(8)9/h1-4,6,13H,5,7,12H2.
What are the key properties of N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine?
N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine has a molecular weight of 232.24 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-nitroquinolin-8-yl)ethane-1,2-diamine is sourced from PubChem (CID 2829587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).