About 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide
2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide (PubChem CID 2829724) has the molecular formula C16H15N3O2
and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide |
| PubChem CID | 2829724 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide |
| SMILES | O=C(CC1Nc2ccccc2NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15N3O2/c20-15(17-11-6-2-1-3-7-11)10-14-16(21)19-13-9-5-4-8-12(13)18-14/h1-9,14,18H,10H2,(H,17,20)(H,19,21) |
| InChIKey | KJTNMDRAZRYXNY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide?
The IUPAC name of 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide (CID 2829724) is 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide.
What is the SMILES notation for 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide?
The canonical SMILES for 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide is O=C(CC1Nc2ccccc2NC1=O)Nc1ccccc1.
What is the InChIKey of 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide?
The InChIKey is KJTNMDRAZRYXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2/c20-15(17-11-6-2-1-3-7-11)10-14-16(21)19-13-9-5-4-8-12(13)18-14/h1-9,14,18H,10H2,(H,17,20)(H,19,21).
What are the key properties of 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide?
2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide has a molecular weight of 281.31 g/mol, XLogP of 2.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-2,4-dihydro-1H-quinoxalin-2-yl)-N-phenylacetamide is sourced from PubChem (CID 2829724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).