About 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine
2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine (PubChem CID 28298) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine |
| PubChem CID | 28298 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSC1=NCCN1 |
| InChI | InChI=1S/C9H19N3S/c1-3-12(4-2)7-8-13-9-10-5-6-11-9/h3-8H2,1-2H3,(H,10,11) |
| InChIKey | UDAYLABGJCKNED-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine (CID 28298) is 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine is CCN(CC)CCSC1=NCCN1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine?
The InChIKey is UDAYLABGJCKNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3S/c1-3-12(4-2)7-8-13-9-10-5-6-11-9/h3-8H2,1-2H3,(H,10,11).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine?
2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine has a molecular weight of 201.34 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-N,N-diethylethanamine is sourced from PubChem (CID 28298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).