C17H22N4O4S — CID 2829832
4-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;oxalic acid (PubChem CID 2829832) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;oxalic acid.
| Compound Name | 4-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;oxalic acid |
|---|---|
| PubChem CID | 2829832 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine;oxalic acid |
| SMILES | CN1CCN(c2ncnc3sc4c(c23)CCCC4)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H20N4S.C2H2O4/c1-18-6-8-19(9-7-18)14-13-11-4-2-3-5-12(11)20-15(13)17-10-16-14;3-1(4)2(5)6/h10H,2-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OOVBNNRRGXYOJV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|