About methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate
methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate (PubChem CID 2829863) has the molecular formula C10H10Cl3NO2S
and a molecular weight of 314.62 g/mol. Its IUPAC name is methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate |
| PubChem CID | 2829863 |
| Molecular Formula | C10H10Cl3NO2S |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate |
| SMILES | COC(=O)NC(Sc1ccc(Cl)cc1)C(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NO2S/c1-16-10(15)14-9(8(12)13)17-7-4-2-6(11)3-5-7/h2-5,8-9H,1H3,(H,14,15) |
| InChIKey | OOPSOBZLVAZZRL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate?
The IUPAC name of methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate (CID 2829863) is methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate.
What is the SMILES notation for methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate?
The canonical SMILES for methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate is COC(=O)NC(Sc1ccc(Cl)cc1)C(Cl)Cl.
What is the InChIKey of methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate?
The InChIKey is OOPSOBZLVAZZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl3NO2S/c1-16-10(15)14-9(8(12)13)17-7-4-2-6(11)3-5-7/h2-5,8-9H,1H3,(H,14,15).
What are the key properties of methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate?
methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate has a molecular weight of 314.62 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2,2-dichloro-1-(4-chlorophenyl)sulfanylethyl]carbamate is sourced from PubChem (CID 2829863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).