C29H24Cl2IN2OP — CID 2830111
[2-(2,4-dichlorophenyl)-5-(dimethylamino)-1,3-oxazol-4-yl]-triphenylphosphanium iodide (PubChem CID 2830111) has the molecular formula C29H24Cl2IN2OP and a molecular weight of 645.31 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-5-(dimethylamino)-1,3-oxazol-4-yl]-triphenylphosphanium iodide.
| Compound Name | [2-(2,4-dichlorophenyl)-5-(dimethylamino)-1,3-oxazol-4-yl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 2830111 |
| Molecular Formula | C29H24Cl2IN2OP |
| Molecular Weight | 645.31 g/mol |
| Exact Mass | 644.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-5-(dimethylamino)-1,3-oxazol-4-yl]-triphenylphosphanium iodide |
| SMILES | CN(C)c1oc(-c2ccc(Cl)cc2Cl)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C29H24Cl2N2OP.HI/c1-33(2)29-28(32-27(34-29)25-19-18-21(30)20-26(25)31)35(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24;/h3-20H,1-2H3;1H/q+1;/p-1 |
| InChIKey | SCGILJOTDKHOMB-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|