About (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium
(5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium (PubChem CID 2830114) has the molecular formula C33H26N2OP+
and a molecular weight of 497.56 g/mol. Its IUPAC name is (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium.
Molecular Properties
| Compound Name | (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium |
| PubChem CID | 2830114 |
| Molecular Formula | C33H26N2OP+ |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium |
| SMILES | c1ccc(Nc2oc(-c3ccccc3)nc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H26N2OP/c1-6-16-26(17-7-1)31-35-33(32(36-31)34-27-18-8-2-9-19-27)37(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25,34H/q+1 |
| InChIKey | UCRUXUSJZCEZTO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium?
The IUPAC name of (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium (CID 2830114) is (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium.
What is the SMILES notation for (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium?
The canonical SMILES for (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium is c1ccc(Nc2oc(-c3ccccc3)nc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium?
The InChIKey is UCRUXUSJZCEZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H26N2OP/c1-6-16-26(17-7-1)31-35-33(32(36-31)34-27-18-8-2-9-19-27)37(28-20-10-3-11-21-28,29-22-12-4-13-23-29)30-24-14-5-15-25-30/h1-25,34H/q+1.
What are the key properties of (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium?
(5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium has a molecular weight of 497.56 g/mol, XLogP of 6.70, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-anilino-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium is sourced from PubChem (CID 2830114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).