About 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride
3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride (PubChem CID 2830166) has the molecular formula C8H16ClNO2S
and a molecular weight of 225.74 g/mol. Its IUPAC name is 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride |
| PubChem CID | 2830166 |
| Molecular Formula | C8H16ClNO2S |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride |
| SMILES | C=CCNC1(C)CCS(=O)(=O)C1.Cl |
| InChI | InChI=1S/C8H15NO2S.ClH/c1-3-5-9-8(2)4-6-12(10,11)7-8;/h3,9H,1,4-7H2,2H3;1H |
| InChIKey | RWCWUBODBXPCGP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride?
The IUPAC name of 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride (CID 2830166) is 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride.
What is the SMILES notation for 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride?
The canonical SMILES for 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride is C=CCNC1(C)CCS(=O)(=O)C1.Cl.
What is the InChIKey of 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride?
The InChIKey is RWCWUBODBXPCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S.ClH/c1-3-5-9-8(2)4-6-12(10,11)7-8;/h3,9H,1,4-7H2,2H3;1H.
What are the key properties of 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride?
3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride has a molecular weight of 225.74 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-dioxo-N-prop-2-enylthiolan-3-amine;hydrochloride is sourced from PubChem (CID 2830166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).