About 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride
2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride (PubChem CID 2830197) has the molecular formula C12H17ClN2O3
and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride |
| PubChem CID | 2830197 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride |
| SMILES | O=C(OCC[NH+]1CCOCC1)c1cccnc1.[Cl-] |
| InChI | InChI=1S/C12H16N2O3.ClH/c15-12(11-2-1-3-13-10-11)17-9-6-14-4-7-16-8-5-14;/h1-3,10H,4-9H2;1H |
| InChIKey | ZSWXNEGKABIPID-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride?
The IUPAC name of 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride (CID 2830197) is 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride.
What is the SMILES notation for 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride?
The canonical SMILES for 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride is O=C(OCC[NH+]1CCOCC1)c1cccnc1.[Cl-].
What is the InChIKey of 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride?
The InChIKey is ZSWXNEGKABIPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.ClH/c15-12(11-2-1-3-13-10-11)17-9-6-14-4-7-16-8-5-14;/h1-3,10H,4-9H2;1H.
What are the key properties of 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride?
2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride has a molecular weight of 272.73 g/mol, XLogP of -3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ium-4-ylethyl pyridine-3-carboxylate chloride is sourced from PubChem (CID 2830197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).