About pyridine-2,3-dicarbonitrile
pyridine-2,3-dicarbonitrile (PubChem CID 28302) has the molecular formula C7H3N3
and a molecular weight of 129.12 g/mol. Its IUPAC name is pyridine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | pyridine-2,3-dicarbonitrile |
| PubChem CID | 28302 |
| Molecular Formula | C7H3N3 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | pyridine-2,3-dicarbonitrile |
| SMILES | N#Cc1cccnc1C#N |
| InChI | InChI=1S/C7H3N3/c8-4-6-2-1-3-10-7(6)5-9/h1-3H |
| InChIKey | GHFGOVUYCKZOJH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,3-dicarbonitrile?
The IUPAC name of pyridine-2,3-dicarbonitrile (CID 28302) is pyridine-2,3-dicarbonitrile.
What is the SMILES notation for pyridine-2,3-dicarbonitrile?
The canonical SMILES for pyridine-2,3-dicarbonitrile is N#Cc1cccnc1C#N.
What is the InChIKey of pyridine-2,3-dicarbonitrile?
The InChIKey is GHFGOVUYCKZOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3/c8-4-6-2-1-3-10-7(6)5-9/h1-3H.
What are the key properties of pyridine-2,3-dicarbonitrile?
pyridine-2,3-dicarbonitrile has a molecular weight of 129.12 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,3-dicarbonitrile is sourced from PubChem (CID 28302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).